C10H17N3 — CID 115117395
1-N-(1H-pyrrol-3-ylmethyl)cyclopentane-1,2-diamine (PubChem CID 115117395) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is 1-N-(1H-pyrrol-3-ylmethyl)cyclopentane-1,2-diamine.
| Compound Name | 1-N-(1H-pyrrol-3-ylmethyl)cyclopentane-1,2-diamine |
|---|---|
| PubChem CID | 115117395 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 1-N-(1H-pyrrol-3-ylmethyl)cyclopentane-1,2-diamine |
| SMILES | NC1CCCC1NCc1cc[nH]c1 |
| InChI | InChI=1S/C10H17N3/c11-9-2-1-3-10(9)13-7-8-4-5-12-6-8/h4-6,9-10,12-13H,1-3,7,11H2 |
| InChIKey | CLHREEXRWRYNNF-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 53.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |