C12H18N2 — CID 66408115
N-(1H-pyrrol-3-ylmethyl)bicyclo[2.2.1]heptan-2-amine (PubChem CID 66408115) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is N-(1H-pyrrol-3-ylmethyl)bicyclo[2.2.1]heptan-2-amine.
| Compound Name | N-(1H-pyrrol-3-ylmethyl)bicyclo[2.2.1]heptan-2-amine |
|---|---|
| PubChem CID | 66408115 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | N-(1H-pyrrol-3-ylmethyl)bicyclo[2.2.1]heptan-2-amine |
| SMILES | c1cc(CNC2CC3CCC2C3)c[nH]1 |
| InChI | InChI=1S/C12H18N2/c1-2-11-5-9(1)6-12(11)14-8-10-3-4-13-7-10/h3-4,7,9,11-14H,1-2,5-6,8H2 |
| InChIKey | FDFGKYFRSCNXFS-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |