C15H20BrN — CID 105401525
N-[(3-bromo-4-methylphenyl)methyl]bicyclo[2.2.1]heptan-2-amine (PubChem CID 105401525) has the molecular formula C15H20BrN and a molecular weight of 294.24 g/mol. Its IUPAC name is N-[(3-bromo-4-methylphenyl)methyl]bicyclo[2.2.1]heptan-2-amine.
| Compound Name | N-[(3-bromo-4-methylphenyl)methyl]bicyclo[2.2.1]heptan-2-amine |
|---|---|
| PubChem CID | 105401525 |
| Molecular Formula | C15H20BrN |
| Molecular Weight | 294.24 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | N-[(3-bromo-4-methylphenyl)methyl]bicyclo[2.2.1]heptan-2-amine |
| SMILES | Cc1ccc(CNC2CC3CCC2C3)cc1Br |
| InChI | InChI=1S/C15H20BrN/c1-10-2-3-12(7-14(10)16)9-17-15-8-11-4-5-13(15)6-11/h2-3,7,11,13,15,17H,4-6,8-9H2,1H3 |
| InChIKey | UYGYMPJMBZWGLB-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.24 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |