C20H32N2 — CID 58270673
N'-(2-bicyclo[2.2.1]heptanyl)-N-[3-(3,4-dimethylphenyl)propyl]ethane-1,2-diamine (PubChem CID 58270673) has the molecular formula C20H32N2 and a molecular weight of 300.49 g/mol. Its IUPAC name is N'-(2-bicyclo[2.2.1]heptanyl)-N-[3-(3,4-dimethylphenyl)propyl]ethane-1,2-diamine.
| Compound Name | N'-(2-bicyclo[2.2.1]heptanyl)-N-[3-(3,4-dimethylphenyl)propyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 58270673 |
| Molecular Formula | C20H32N2 |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 300.26 |
| IUPAC Name | N'-(2-bicyclo[2.2.1]heptanyl)-N-[3-(3,4-dimethylphenyl)propyl]ethane-1,2-diamine |
| SMILES | Cc1ccc(CCCNCCNC2CC3CCC2C3)cc1C |
| InChI | InChI=1S/C20H32N2/c1-15-5-6-17(12-16(15)2)4-3-9-21-10-11-22-20-14-18-7-8-19(20)13-18/h5-6,12,18-22H,3-4,7-11,13-14H2,1-2H3 |
| InChIKey | GUMOTCJEFLEDKR-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|