C15H21N — CID 59101629
(1S,4R)-N-(2-phenylethyl)bicyclo[2.2.1]heptan-2-amine (PubChem CID 59101629) has the molecular formula C15H21N and a molecular weight of 215.34 g/mol. Its IUPAC name is (1S,4R)-N-(2-phenylethyl)bicyclo[2.2.1]heptan-2-amine.
| Compound Name | (1S,4R)-N-(2-phenylethyl)bicyclo[2.2.1]heptan-2-amine |
|---|---|
| PubChem CID | 59101629 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | (1S,4R)-N-(2-phenylethyl)bicyclo[2.2.1]heptan-2-amine |
| SMILES | c1ccc(CCNC2C[C@@H]3CC[C@H]2C3)cc1 |
| InChI | InChI=1S/C15H21N/c1-2-4-12(5-3-1)8-9-16-15-11-13-6-7-14(15)10-13/h1-5,13-16H,6-11H2/t13-,14+,15?/m1/s1 |
| InChIKey | UOJWJKSWEPSVQD-GNXJLENFSA-N |
| XLogP | 3.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |