C24H32N2 — CID 3006127
N'-[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]-N-(3,3-diphenylpropyl)ethane-1,2-diamine (PubChem CID 3006127) has the molecular formula C24H32N2 and a molecular weight of 348.53 g/mol. Its IUPAC name is N'-[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]-N-(3,3-diphenylpropyl)ethane-1,2-diamine.
| Compound Name | N'-[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]-N-(3,3-diphenylpropyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 3006127 |
| Molecular Formula | C24H32N2 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.26 |
| IUPAC Name | N'-[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]-N-(3,3-diphenylpropyl)ethane-1,2-diamine |
| SMILES | c1ccc(C(CCNCCN[C@H]2C[C@@H]3CC[C@H]2C3)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H32N2/c1-3-7-20(8-4-1)23(21-9-5-2-6-10-21)13-14-25-15-16-26-24-18-19-11-12-22(24)17-19/h1-10,19,22-26H,11-18H2/t19-,22+,24+/m1/s1 |
| InChIKey | SOEYDSWDRIGNJR-UCFCWBNQSA-N |
| XLogP | 4.58 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|