C28H42N2 — CID 90744195
(1R,5S)-6,6-dimethylbicyclo[3.1.1]heptane;N'-(3,3-diphenylpropyl)-N-ethylethane-1,2-diamine (PubChem CID 90744195) has the molecular formula C28H42N2 and a molecular weight of 406.66 g/mol. Its IUPAC name is (1R,5S)-6,6-dimethylbicyclo[3.1.1]heptane;N'-(3,3-diphenylpropyl)-N-ethylethane-1,2-diamine.
| Compound Name | (1R,5S)-6,6-dimethylbicyclo[3.1.1]heptane;N'-(3,3-diphenylpropyl)-N-ethylethane-1,2-diamine |
|---|---|
| PubChem CID | 90744195 |
| Molecular Formula | C28H42N2 |
| Molecular Weight | 406.66 g/mol |
| Exact Mass | 406.33 |
| IUPAC Name | (1R,5S)-6,6-dimethylbicyclo[3.1.1]heptane;N'-(3,3-diphenylpropyl)-N-ethylethane-1,2-diamine |
| SMILES | CC1(C)[C@@H]2CCC[C@H]1C2.CCNCCNCCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H26N2.C9H16/c1-2-20-15-16-21-14-13-19(17-9-5-3-6-10-17)18-11-7-4-8-12-18;1-9(2)7-4-3-5-8(9)6-7/h3-12,19-21H,2,13-16H2,1H3;7-8H,3-6H2,1-2H3/t;7-,8+ |
| InChIKey | ICXGPECLIRMCDK-YIEIKVQRSA-N |
| XLogP | 6.24 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.66 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|