C17H27N — CID 65308417
N-[6-(3,4-dimethylphenyl)hexyl]cyclopropanamine (PubChem CID 65308417) has the molecular formula C17H27N and a molecular weight of 245.41 g/mol. Its IUPAC name is N-[6-(3,4-dimethylphenyl)hexyl]cyclopropanamine.
| Compound Name | N-[6-(3,4-dimethylphenyl)hexyl]cyclopropanamine |
|---|---|
| PubChem CID | 65308417 |
| Molecular Formula | C17H27N |
| Molecular Weight | 245.41 g/mol |
| Exact Mass | 245.21 |
| IUPAC Name | N-[6-(3,4-dimethylphenyl)hexyl]cyclopropanamine |
| SMILES | Cc1ccc(CCCCCCNC2CC2)cc1C |
| InChI | InChI=1S/C17H27N/c1-14-8-9-16(13-15(14)2)7-5-3-4-6-12-18-17-10-11-17/h8-9,13,17-18H,3-7,10-12H2,1-2H3 |
| InChIKey | GIUJGJFAKDZWNG-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.41 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|