C17H25NO — CID 65305644
N-[5-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)pentyl]cyclopropanamine (PubChem CID 65305644) has the molecular formula C17H25NO and a molecular weight of 259.39 g/mol. Its IUPAC name is N-[5-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)pentyl]cyclopropanamine.
| Compound Name | N-[5-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)pentyl]cyclopropanamine |
|---|---|
| PubChem CID | 65305644 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | N-[5-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)pentyl]cyclopropanamine |
| SMILES | CC1Cc2cc(CCCCCNC3CC3)ccc2O1 |
| InChI | InChI=1S/C17H25NO/c1-13-11-15-12-14(6-9-17(15)19-13)5-3-2-4-10-18-16-7-8-16/h6,9,12-13,16,18H,2-5,7-8,10-11H2,1H3 |
| InChIKey | CMBVFZBIILBOIU-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|