C16H25N — CID 62551613
N-[2-(3,4-dimethylphenyl)ethyl]cyclohexanamine (PubChem CID 62551613) has the molecular formula C16H25N and a molecular weight of 231.38 g/mol. Its IUPAC name is N-[2-(3,4-dimethylphenyl)ethyl]cyclohexanamine.
| Compound Name | N-[2-(3,4-dimethylphenyl)ethyl]cyclohexanamine |
|---|---|
| PubChem CID | 62551613 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | N-[2-(3,4-dimethylphenyl)ethyl]cyclohexanamine |
| SMILES | Cc1ccc(CCNC2CCCCC2)cc1C |
| InChI | InChI=1S/C16H25N/c1-13-8-9-15(12-14(13)2)10-11-17-16-6-4-3-5-7-16/h8-9,12,16-17H,3-7,10-11H2,1-2H3 |
| InChIKey | RGWCYMQJNFVDKU-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |