C18H29N — CID 98017018
N-[4-(2,4,5-trimethylphenyl)butyl]cyclopentanamine (PubChem CID 98017018) has the molecular formula C18H29N and a molecular weight of 259.44 g/mol. Its IUPAC name is N-[4-(2,4,5-trimethylphenyl)butyl]cyclopentanamine.
| Compound Name | N-[4-(2,4,5-trimethylphenyl)butyl]cyclopentanamine |
|---|---|
| PubChem CID | 98017018 |
| Molecular Formula | C18H29N |
| Molecular Weight | 259.44 g/mol |
| Exact Mass | 259.23 |
| IUPAC Name | N-[4-(2,4,5-trimethylphenyl)butyl]cyclopentanamine |
| SMILES | Cc1cc(C)c(CCCCNC2CCCC2)cc1C |
| InChI | InChI=1S/C18H29N/c1-14-12-16(3)17(13-15(14)2)8-6-7-11-19-18-9-4-5-10-18/h12-13,18-19H,4-11H2,1-3H3 |
| InChIKey | VHHXAPFQJPHFOK-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.44 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|