C18H24BrN — CID 105401271
N-[(3-bromo-4-methylphenyl)methyl]adamantan-2-amine (PubChem CID 105401271) has the molecular formula C18H24BrN and a molecular weight of 334.30 g/mol. Its IUPAC name is N-[(3-bromo-4-methylphenyl)methyl]adamantan-2-amine.
| Compound Name | N-[(3-bromo-4-methylphenyl)methyl]adamantan-2-amine |
|---|---|
| PubChem CID | 105401271 |
| Molecular Formula | C18H24BrN |
| Molecular Weight | 334.30 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | N-[(3-bromo-4-methylphenyl)methyl]adamantan-2-amine |
| SMILES | Cc1ccc(CNC2C3CC4CC(C3)CC2C4)cc1Br |
| InChI | InChI=1S/C18H24BrN/c1-11-2-3-12(9-17(11)19)10-20-18-15-5-13-4-14(7-15)8-16(18)6-13/h2-3,9,13-16,18,20H,4-8,10H2,1H3 |
| InChIKey | XANSDDNBOPLUDB-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.30 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |