C10H14BrN — CID 81471854
N-[(3-bromo-4-methylphenyl)methyl]ethanamine (PubChem CID 81471854) has the molecular formula C10H14BrN and a molecular weight of 228.13 g/mol. Its IUPAC name is N-[(3-bromo-4-methylphenyl)methyl]ethanamine.
| Compound Name | N-[(3-bromo-4-methylphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 81471854 |
| Molecular Formula | C10H14BrN |
| Molecular Weight | 228.13 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | N-[(3-bromo-4-methylphenyl)methyl]ethanamine |
| SMILES | CCNCc1ccc(C)c(Br)c1 |
| InChI | InChI=1S/C10H14BrN/c1-3-12-7-9-5-4-8(2)10(11)6-9/h4-6,12H,3,7H2,1-2H3 |
| InChIKey | NUQNXXBYODGKEN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.13 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |