C16H23NO2 — CID 23736358
N-[(3,5-dimethoxyphenyl)methyl]bicyclo[2.2.1]heptan-2-amine (PubChem CID 23736358) has the molecular formula C16H23NO2 and a molecular weight of 261.36 g/mol. Its IUPAC name is N-[(3,5-dimethoxyphenyl)methyl]bicyclo[2.2.1]heptan-2-amine.
| Compound Name | N-[(3,5-dimethoxyphenyl)methyl]bicyclo[2.2.1]heptan-2-amine |
|---|---|
| PubChem CID | 23736358 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | N-[(3,5-dimethoxyphenyl)methyl]bicyclo[2.2.1]heptan-2-amine |
| SMILES | COc1cc(CNC2CC3CCC2C3)cc(OC)c1 |
| InChI | InChI=1S/C16H23NO2/c1-18-14-6-12(7-15(9-14)19-2)10-17-16-8-11-3-4-13(16)5-11/h6-7,9,11,13,16-17H,3-5,8,10H2,1-2H3 |
| InChIKey | XAFMGMIXOREPAN-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |