C17H21N3 — CID 61309951
N-[[4-(1H-pyrazol-5-yl)phenyl]methyl]bicyclo[2.2.1]heptan-2-amine (PubChem CID 61309951) has the molecular formula C17H21N3 and a molecular weight of 267.38 g/mol. Its IUPAC name is N-[[4-(1H-pyrazol-5-yl)phenyl]methyl]bicyclo[2.2.1]heptan-2-amine.
| Compound Name | N-[[4-(1H-pyrazol-5-yl)phenyl]methyl]bicyclo[2.2.1]heptan-2-amine |
|---|---|
| PubChem CID | 61309951 |
| Molecular Formula | C17H21N3 |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | N-[[4-(1H-pyrazol-5-yl)phenyl]methyl]bicyclo[2.2.1]heptan-2-amine |
| SMILES | c1cc(-c2ccc(CNC3CC4CCC3C4)cc2)[nH]n1 |
| InChI | InChI=1S/C17H21N3/c1-4-14(16-7-8-19-20-16)5-2-12(1)11-18-17-10-13-3-6-15(17)9-13/h1-2,4-5,7-8,13,15,17-18H,3,6,9-11H2,(H,19,20) |
| InChIKey | KPQWPUFDBKBOIT-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |