C18H22N4S — CID 98890356
1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-[[4-(1H-pyrazol-5-yl)phenyl]methyl]thiourea (PubChem CID 98890356) has the molecular formula C18H22N4S and a molecular weight of 326.47 g/mol. Its IUPAC name is 1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-[[4-(1H-pyrazol-5-yl)phenyl]methyl]thiourea.
| Compound Name | 1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-[[4-(1H-pyrazol-5-yl)phenyl]methyl]thiourea |
|---|---|
| PubChem CID | 98890356 |
| Molecular Formula | C18H22N4S |
| Molecular Weight | 326.47 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-[[4-(1H-pyrazol-5-yl)phenyl]methyl]thiourea |
| SMILES | S=C(NCc1ccc(-c2ccn[nH]2)cc1)N[C@H]1C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C18H22N4S/c23-18(21-17-10-13-3-6-15(17)9-13)19-11-12-1-4-14(5-2-12)16-7-8-20-22-16/h1-2,4-5,7-8,13,15,17H,3,6,9-11H2,(H,20,22)(H2,19,21,23)/t13-,15-,17-/m0/s1 |
| InChIKey | JZSIYMJASVKGCC-QRTARXTBSA-N |
| XLogP | 3.23 |
| TPSA | 52.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.47 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|