C14H19N3S — CID 98293669
1-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]-3-(pyridin-3-ylmethyl)thiourea (PubChem CID 98293669) has the molecular formula C14H19N3S and a molecular weight of 261.39 g/mol. Its IUPAC name is 1-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]-3-(pyridin-3-ylmethyl)thiourea.
| Compound Name | 1-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]-3-(pyridin-3-ylmethyl)thiourea |
|---|---|
| PubChem CID | 98293669 |
| Molecular Formula | C14H19N3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 1-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]-3-(pyridin-3-ylmethyl)thiourea |
| SMILES | S=C(NCc1cccnc1)N[C@H]1C[C@@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C14H19N3S/c18-14(16-9-11-2-1-5-15-8-11)17-13-7-10-3-4-12(13)6-10/h1-2,5,8,10,12-13H,3-4,6-7,9H2,(H2,16,17,18)/t10-,12-,13+/m1/s1 |
| InChIKey | KRXLFISDTSFABS-RTXFEEFZSA-N |
| XLogP | 2.23 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|