C10H15N3S — CID 19686579
1-propyl-3-(pyridin-3-ylmethyl)thiourea (PubChem CID 19686579) has the molecular formula C10H15N3S and a molecular weight of 209.32 g/mol. Its IUPAC name is 1-propyl-3-(pyridin-3-ylmethyl)thiourea.
| Compound Name | 1-propyl-3-(pyridin-3-ylmethyl)thiourea |
|---|---|
| PubChem CID | 19686579 |
| Molecular Formula | C10H15N3S |
| Molecular Weight | 209.32 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 1-propyl-3-(pyridin-3-ylmethyl)thiourea |
| SMILES | CCCNC(=S)NCc1cccnc1 |
| InChI | InChI=1S/C10H15N3S/c1-2-5-12-10(14)13-8-9-4-3-6-11-7-9/h3-4,6-7H,2,5,8H2,1H3,(H2,12,13,14) |
| InChIKey | FWRYATVELTVRAL-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.32 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|