C9H13N3S — CID 2731465
1,1-dimethyl-3-(pyridin-3-ylmethyl)thiourea (PubChem CID 2731465) has the molecular formula C9H13N3S and a molecular weight of 195.29 g/mol. Its IUPAC name is 1,1-dimethyl-3-(pyridin-3-ylmethyl)thiourea.
| Compound Name | 1,1-dimethyl-3-(pyridin-3-ylmethyl)thiourea |
|---|---|
| PubChem CID | 2731465 |
| Molecular Formula | C9H13N3S |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | 1,1-dimethyl-3-(pyridin-3-ylmethyl)thiourea |
| SMILES | CN(C)C(=S)NCc1cccnc1 |
| InChI | InChI=1S/C9H13N3S/c1-12(2)9(13)11-7-8-4-3-5-10-6-8/h3-6H,7H2,1-2H3,(H,11,13) |
| InChIKey | QQERVKDBLVWZQW-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|