C16H20N4 — CID 111023402
3-benzyl-1,1-dimethyl-2-(pyridin-3-ylmethyl)guanidine (PubChem CID 111023402) has the molecular formula C16H20N4 and a molecular weight of 268.36 g/mol. Its IUPAC name is 3-benzyl-1,1-dimethyl-2-(pyridin-3-ylmethyl)guanidine.
| Compound Name | 3-benzyl-1,1-dimethyl-2-(pyridin-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111023402 |
| Molecular Formula | C16H20N4 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 3-benzyl-1,1-dimethyl-2-(pyridin-3-ylmethyl)guanidine |
| SMILES | CN(C)/C(=N\Cc1cccnc1)NCc1ccccc1 |
| InChI | InChI=1S/C16H20N4/c1-20(2)16(18-12-14-7-4-3-5-8-14)19-13-15-9-6-10-17-11-15/h3-11H,12-13H2,1-2H3,(H,18,19) |
| InChIKey | MNASCJAIYHFSMC-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|