C18H20N4 — CID 111052373
2-benzyl-3-[(4-cyanophenyl)methyl]-1,1-dimethylguanidine (PubChem CID 111052373) has the molecular formula C18H20N4 and a molecular weight of 292.39 g/mol. Its IUPAC name is 2-benzyl-3-[(4-cyanophenyl)methyl]-1,1-dimethylguanidine.
| Compound Name | 2-benzyl-3-[(4-cyanophenyl)methyl]-1,1-dimethylguanidine |
|---|---|
| PubChem CID | 111052373 |
| Molecular Formula | C18H20N4 |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 2-benzyl-3-[(4-cyanophenyl)methyl]-1,1-dimethylguanidine |
| SMILES | CN(C)/C(=N\Cc1ccccc1)NCc1ccc(C#N)cc1 |
| InChI | InChI=1S/C18H20N4/c1-22(2)18(20-13-16-6-4-3-5-7-16)21-14-17-10-8-15(12-19)9-11-17/h3-11H,13-14H2,1-2H3,(H,20,21) |
| InChIKey | ZXHYXULBJRCZQF-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 51.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|