C18H22N4O — CID 111030268
4-[[(N'-benzyl-N,N-dimethylcarbamimidoyl)amino]methyl]benzamide (PubChem CID 111030268) has the molecular formula C18H22N4O and a molecular weight of 310.40 g/mol. Its IUPAC name is 4-[[(N'-benzyl-N,N-dimethylcarbamimidoyl)amino]methyl]benzamide.
| Compound Name | 4-[[(N'-benzyl-N,N-dimethylcarbamimidoyl)amino]methyl]benzamide |
|---|---|
| PubChem CID | 111030268 |
| Molecular Formula | C18H22N4O |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 4-[[(N'-benzyl-N,N-dimethylcarbamimidoyl)amino]methyl]benzamide |
| SMILES | CN(C)/C(=N\Cc1ccccc1)NCc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C18H22N4O/c1-22(2)18(20-12-14-6-4-3-5-7-14)21-13-15-8-10-16(11-9-15)17(19)23/h3-11H,12-13H2,1-2H3,(H2,19,23)(H,20,21) |
| InChIKey | JTHLXLYIDJSUBI-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|