C19H24N4O — CID 111048456
4-[[(N'-benzyl-N,N-dimethylcarbamimidoyl)amino]methyl]-N-methylbenzamide (PubChem CID 111048456) has the molecular formula C19H24N4O and a molecular weight of 324.43 g/mol. Its IUPAC name is 4-[[(N'-benzyl-N,N-dimethylcarbamimidoyl)amino]methyl]-N-methylbenzamide.
| Compound Name | 4-[[(N'-benzyl-N,N-dimethylcarbamimidoyl)amino]methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 111048456 |
| Molecular Formula | C19H24N4O |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | 4-[[(N'-benzyl-N,N-dimethylcarbamimidoyl)amino]methyl]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(CN/C(=N/Cc2ccccc2)N(C)C)cc1 |
| InChI | InChI=1S/C19H24N4O/c1-20-18(24)17-11-9-16(10-12-17)14-22-19(23(2)3)21-13-15-7-5-4-6-8-15/h4-12H,13-14H2,1-3H3,(H,20,24)(H,21,22) |
| InChIKey | PGOJBGPEUDVNCE-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|