C18H25IN4O2S — CID 119118038
3-benzyl-2-[[3-(methanesulfonamido)phenyl]methyl]-1,1-dimethylguanidine;hydroiodide (PubChem CID 119118038) has the molecular formula C18H25IN4O2S and a molecular weight of 488.40 g/mol. Its IUPAC name is 3-benzyl-2-[[3-(methanesulfonamido)phenyl]methyl]-1,1-dimethylguanidine;hydroiodide.
| Compound Name | 3-benzyl-2-[[3-(methanesulfonamido)phenyl]methyl]-1,1-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 119118038 |
| Molecular Formula | C18H25IN4O2S |
| Molecular Weight | 488.40 g/mol |
| Exact Mass | 488.07 |
| IUPAC Name | 3-benzyl-2-[[3-(methanesulfonamido)phenyl]methyl]-1,1-dimethylguanidine;hydroiodide |
| SMILES | CN(C)/C(=N\Cc1cccc(NS(C)(=O)=O)c1)NCc1ccccc1.I |
| InChI | InChI=1S/C18H24N4O2S.HI/c1-22(2)18(19-13-15-8-5-4-6-9-15)20-14-16-10-7-11-17(12-16)21-25(3,23)24;/h4-12,21H,13-14H2,1-3H3,(H,19,20);1H |
| InChIKey | JQRDKLCSQDCRFD-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.40 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|