C15H25N5S — CID 63401965
4-[2-(dimethylamino)ethyl]-N-(pyridin-3-ylmethyl)piperazine-1-carbothioamide (PubChem CID 63401965) has the molecular formula C15H25N5S and a molecular weight of 307.47 g/mol. Its IUPAC name is 4-[2-(dimethylamino)ethyl]-N-(pyridin-3-ylmethyl)piperazine-1-carbothioamide.
| Compound Name | 4-[2-(dimethylamino)ethyl]-N-(pyridin-3-ylmethyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 63401965 |
| Molecular Formula | C15H25N5S |
| Molecular Weight | 307.47 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 4-[2-(dimethylamino)ethyl]-N-(pyridin-3-ylmethyl)piperazine-1-carbothioamide |
| SMILES | CN(C)CCN1CCN(C(=S)NCc2cccnc2)CC1 |
| InChI | InChI=1S/C15H25N5S/c1-18(2)6-7-19-8-10-20(11-9-19)15(21)17-13-14-4-3-5-16-12-14/h3-5,12H,6-11,13H2,1-2H3,(H,17,21) |
| InChIKey | HXXIPNINYMWHBP-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 34.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.47 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|