C21H22N4S — CID 19293421
N-naphthalen-1-yl-4-(pyridin-3-ylmethyl)piperazine-1-carbothioamide (PubChem CID 19293421) has the molecular formula C21H22N4S and a molecular weight of 362.50 g/mol. Its IUPAC name is N-naphthalen-1-yl-4-(pyridin-3-ylmethyl)piperazine-1-carbothioamide.
| Compound Name | N-naphthalen-1-yl-4-(pyridin-3-ylmethyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 19293421 |
| Molecular Formula | C21H22N4S |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | N-naphthalen-1-yl-4-(pyridin-3-ylmethyl)piperazine-1-carbothioamide |
| SMILES | S=C(Nc1cccc2ccccc12)N1CCN(Cc2cccnc2)CC1 |
| InChI | InChI=1S/C21H22N4S/c26-21(23-20-9-3-7-18-6-1-2-8-19(18)20)25-13-11-24(12-14-25)16-17-5-4-10-22-15-17/h1-10,15H,11-14,16H2,(H,23,26) |
| InChIKey | XGZWZULTTQGZRY-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|