C19H24N4S — CID 19293442
N-(2,5-dimethylphenyl)-4-(pyridin-3-ylmethyl)piperazine-1-carbothioamide (PubChem CID 19293442) has the molecular formula C19H24N4S and a molecular weight of 340.50 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-4-(pyridin-3-ylmethyl)piperazine-1-carbothioamide.
| Compound Name | N-(2,5-dimethylphenyl)-4-(pyridin-3-ylmethyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 19293442 |
| Molecular Formula | C19H24N4S |
| Molecular Weight | 340.50 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | N-(2,5-dimethylphenyl)-4-(pyridin-3-ylmethyl)piperazine-1-carbothioamide |
| SMILES | Cc1ccc(C)c(NC(=S)N2CCN(Cc3cccnc3)CC2)c1 |
| InChI | InChI=1S/C19H24N4S/c1-15-5-6-16(2)18(12-15)21-19(24)23-10-8-22(9-11-23)14-17-4-3-7-20-13-17/h3-7,12-13H,8-11,14H2,1-2H3,(H,21,24) |
| InChIKey | PBLZORDVLWEWHV-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.50 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|