C20H23F2N3OS — CID 19574253
4-benzyl-N-[2-(difluoromethoxy)-5-methylphenyl]piperazine-1-carbothioamide (PubChem CID 19574253) has the molecular formula C20H23F2N3OS and a molecular weight of 391.49 g/mol. Its IUPAC name is 4-benzyl-N-[2-(difluoromethoxy)-5-methylphenyl]piperazine-1-carbothioamide.
| Compound Name | 4-benzyl-N-[2-(difluoromethoxy)-5-methylphenyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 19574253 |
| Molecular Formula | C20H23F2N3OS |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 4-benzyl-N-[2-(difluoromethoxy)-5-methylphenyl]piperazine-1-carbothioamide |
| SMILES | Cc1ccc(OC(F)F)c(NC(=S)N2CCN(Cc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C20H23F2N3OS/c1-15-7-8-18(26-19(21)22)17(13-15)23-20(27)25-11-9-24(10-12-25)14-16-5-3-2-4-6-16/h2-8,13,19H,9-12,14H2,1H3,(H,23,27) |
| InChIKey | CAEBFORJOVHHFR-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|