C19H20ClF2N3OS — CID 19289683
4-[(4-chlorophenyl)methyl]-N-[2-(difluoromethoxy)phenyl]piperazine-1-carbothioamide (PubChem CID 19289683) has the molecular formula C19H20ClF2N3OS and a molecular weight of 411.91 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)methyl]-N-[2-(difluoromethoxy)phenyl]piperazine-1-carbothioamide.
| Compound Name | 4-[(4-chlorophenyl)methyl]-N-[2-(difluoromethoxy)phenyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 19289683 |
| Molecular Formula | C19H20ClF2N3OS |
| Molecular Weight | 411.91 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | 4-[(4-chlorophenyl)methyl]-N-[2-(difluoromethoxy)phenyl]piperazine-1-carbothioamide |
| SMILES | FC(F)Oc1ccccc1NC(=S)N1CCN(Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C19H20ClF2N3OS/c20-15-7-5-14(6-8-15)13-24-9-11-25(12-10-24)19(27)23-16-3-1-2-4-17(16)26-18(21)22/h1-8,18H,9-13H2,(H,23,27) |
| InChIKey | OLEVYJSHMBAFGX-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.91 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|