C19H22ClN3S — CID 19289652
4-[(4-chlorophenyl)methyl]-N-(4-methylphenyl)piperazine-1-carbothioamide (PubChem CID 19289652) has the molecular formula C19H22ClN3S and a molecular weight of 359.93 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)methyl]-N-(4-methylphenyl)piperazine-1-carbothioamide.
| Compound Name | 4-[(4-chlorophenyl)methyl]-N-(4-methylphenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 19289652 |
| Molecular Formula | C19H22ClN3S |
| Molecular Weight | 359.93 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 4-[(4-chlorophenyl)methyl]-N-(4-methylphenyl)piperazine-1-carbothioamide |
| SMILES | Cc1ccc(NC(=S)N2CCN(Cc3ccc(Cl)cc3)CC2)cc1 |
| InChI | InChI=1S/C19H22ClN3S/c1-15-2-8-18(9-3-15)21-19(24)23-12-10-22(11-13-23)14-16-4-6-17(20)7-5-16/h2-9H,10-14H2,1H3,(H,21,24) |
| InChIKey | LYCHIZUNZNAMFQ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.93 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|