C19H21ClFN3OS — CID 8561289
N-(3-chloro-4-fluorophenyl)-4-[(4-methoxyphenyl)methyl]piperazine-1-carbothioamide (PubChem CID 8561289) has the molecular formula C19H21ClFN3OS and a molecular weight of 393.92 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-4-[(4-methoxyphenyl)methyl]piperazine-1-carbothioamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-4-[(4-methoxyphenyl)methyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 8561289 |
| Molecular Formula | C19H21ClFN3OS |
| Molecular Weight | 393.92 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-4-[(4-methoxyphenyl)methyl]piperazine-1-carbothioamide |
| SMILES | COc1ccc(CN2CCN(C(=S)Nc3ccc(F)c(Cl)c3)CC2)cc1 |
| InChI | InChI=1S/C19H21ClFN3OS/c1-25-16-5-2-14(3-6-16)13-23-8-10-24(11-9-23)19(26)22-15-4-7-18(21)17(20)12-15/h2-7,12H,8-11,13H2,1H3,(H,22,26) |
| InChIKey | FYLOEWGSBBMQMQ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.92 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|