C17H19ClFN3OS2 — CID 166182970
4-[(5-chlorothiophen-2-yl)methyl]-N-(3-fluoro-4-methoxyphenyl)piperazine-1-carbothioamide (PubChem CID 166182970) has the molecular formula C17H19ClFN3OS2 and a molecular weight of 399.94 g/mol. Its IUPAC name is 4-[(5-chlorothiophen-2-yl)methyl]-N-(3-fluoro-4-methoxyphenyl)piperazine-1-carbothioamide.
| Compound Name | 4-[(5-chlorothiophen-2-yl)methyl]-N-(3-fluoro-4-methoxyphenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 166182970 |
| Molecular Formula | C17H19ClFN3OS2 |
| Molecular Weight | 399.94 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | 4-[(5-chlorothiophen-2-yl)methyl]-N-(3-fluoro-4-methoxyphenyl)piperazine-1-carbothioamide |
| SMILES | COc1ccc(NC(=S)N2CCN(Cc3ccc(Cl)s3)CC2)cc1F |
| InChI | InChI=1S/C17H19ClFN3OS2/c1-23-15-4-2-12(10-14(15)19)20-17(24)22-8-6-21(7-9-22)11-13-3-5-16(18)25-13/h2-5,10H,6-9,11H2,1H3,(H,20,24) |
| InChIKey | YBAKVODFKUWZBF-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.94 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|