C21H26ClN3O2S — CID 9098035
N-(4-chlorophenyl)-4-[(4,5-dimethoxy-2-methylphenyl)methyl]piperazine-1-carbothioamide (PubChem CID 9098035) has the molecular formula C21H26ClN3O2S and a molecular weight of 419.98 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-[(4,5-dimethoxy-2-methylphenyl)methyl]piperazine-1-carbothioamide.
| Compound Name | N-(4-chlorophenyl)-4-[(4,5-dimethoxy-2-methylphenyl)methyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 9098035 |
| Molecular Formula | C21H26ClN3O2S |
| Molecular Weight | 419.98 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | N-(4-chlorophenyl)-4-[(4,5-dimethoxy-2-methylphenyl)methyl]piperazine-1-carbothioamide |
| SMILES | COc1cc(C)c(CN2CCN(C(=S)Nc3ccc(Cl)cc3)CC2)cc1OC |
| InChI | InChI=1S/C21H26ClN3O2S/c1-15-12-19(26-2)20(27-3)13-16(15)14-24-8-10-25(11-9-24)21(28)23-18-6-4-17(22)5-7-18/h4-7,12-13H,8-11,14H2,1-3H3,(H,23,28) |
| InChIKey | CLTSLTKIFAKOTQ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.98 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|