C18H27N3O2S — CID 9098031
4-[(4,5-dimethoxy-2-methylphenyl)methyl]-N-prop-2-enylpiperazine-1-carbothioamide (PubChem CID 9098031) has the molecular formula C18H27N3O2S and a molecular weight of 349.50 g/mol. Its IUPAC name is 4-[(4,5-dimethoxy-2-methylphenyl)methyl]-N-prop-2-enylpiperazine-1-carbothioamide.
| Compound Name | 4-[(4,5-dimethoxy-2-methylphenyl)methyl]-N-prop-2-enylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 9098031 |
| Molecular Formula | C18H27N3O2S |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 4-[(4,5-dimethoxy-2-methylphenyl)methyl]-N-prop-2-enylpiperazine-1-carbothioamide |
| SMILES | C=CCNC(=S)N1CCN(Cc2cc(OC)c(OC)cc2C)CC1 |
| InChI | InChI=1S/C18H27N3O2S/c1-5-6-19-18(24)21-9-7-20(8-10-21)13-15-12-17(23-4)16(22-3)11-14(15)2/h5,11-12H,1,6-10,13H2,2-4H3,(H,19,24) |
| InChIKey | CWHVOYWHTFQHFY-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|