C15H20N2O2S — CID 2969305
6,7-dimethoxy-N-prop-2-enyl-3,4-dihydro-1H-isoquinoline-2-carbothioamide (PubChem CID 2969305) has the molecular formula C15H20N2O2S and a molecular weight of 292.40 g/mol. Its IUPAC name is 6,7-dimethoxy-N-prop-2-enyl-3,4-dihydro-1H-isoquinoline-2-carbothioamide.
| Compound Name | 6,7-dimethoxy-N-prop-2-enyl-3,4-dihydro-1H-isoquinoline-2-carbothioamide |
|---|---|
| PubChem CID | 2969305 |
| Molecular Formula | C15H20N2O2S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 6,7-dimethoxy-N-prop-2-enyl-3,4-dihydro-1H-isoquinoline-2-carbothioamide |
| SMILES | C=CCNC(=S)N1CCc2cc(OC)c(OC)cc2C1 |
| InChI | InChI=1S/C15H20N2O2S/c1-4-6-16-15(20)17-7-5-11-8-13(18-2)14(19-3)9-12(11)10-17/h4,8-9H,1,5-7,10H2,2-3H3,(H,16,20) |
| InChIKey | QUNLQNBJWSZHBO-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|