C23H28N2O4S — CID 2224500
(1S)-1-(3,4-dimethoxyphenyl)-6,7-dimethoxy-N-prop-2-enyl-3,4-dihydro-1H-isoquinoline-2-carbothioamide (PubChem CID 2224500) has the molecular formula C23H28N2O4S and a molecular weight of 428.55 g/mol. Its IUPAC name is (1S)-1-(3,4-dimethoxyphenyl)-6,7-dimethoxy-N-prop-2-enyl-3,4-dihydro-1H-isoquinoline-2-carbothioamide.
| Compound Name | (1S)-1-(3,4-dimethoxyphenyl)-6,7-dimethoxy-N-prop-2-enyl-3,4-dihydro-1H-isoquinoline-2-carbothioamide |
|---|---|
| PubChem CID | 2224500 |
| Molecular Formula | C23H28N2O4S |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | (1S)-1-(3,4-dimethoxyphenyl)-6,7-dimethoxy-N-prop-2-enyl-3,4-dihydro-1H-isoquinoline-2-carbothioamide |
| SMILES | C=CCNC(=S)N1CCc2cc(OC)c(OC)cc2[C@@H]1c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C23H28N2O4S/c1-6-10-24-23(30)25-11-9-15-12-20(28-4)21(29-5)14-17(15)22(25)16-7-8-18(26-2)19(13-16)27-3/h6-8,12-14,22H,1,9-11H2,2-5H3,(H,24,30)/t22-/m0/s1 |
| InChIKey | ZBYWDWNKQVSJAC-QFIPXVFZSA-N |
| XLogP | 3.73 |
| TPSA | 52.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|