C26H26N2O7 — CID 2223283
[(1S)-1-(3,4-dimethoxyphenyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]-(4-nitrophenyl)methanone (PubChem CID 2223283) has the molecular formula C26H26N2O7 and a molecular weight of 478.50 g/mol. Its IUPAC name is [(1S)-1-(3,4-dimethoxyphenyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]-(4-nitrophenyl)methanone.
| Compound Name | [(1S)-1-(3,4-dimethoxyphenyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]-(4-nitrophenyl)methanone |
|---|---|
| PubChem CID | 2223283 |
| Molecular Formula | C26H26N2O7 |
| Molecular Weight | 478.50 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | [(1S)-1-(3,4-dimethoxyphenyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]-(4-nitrophenyl)methanone |
| SMILES | COc1ccc([C@H]2c3cc(OC)c(OC)cc3CCN2C(=O)c2ccc([N+](=O)[O-])cc2)cc1OC |
| InChI | InChI=1S/C26H26N2O7/c1-32-21-10-7-18(14-22(21)33-2)25-20-15-24(35-4)23(34-3)13-17(20)11-12-27(25)26(29)16-5-8-19(9-6-16)28(30)31/h5-10,13-15,25H,11-12H2,1-4H3/t25-/m0/s1 |
| InChIKey | UBINKGNJUBAXBM-VWLOTQADSA-N |
| XLogP | 4.42 |
| TPSA | 100.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.50 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|