C27H28N2O6 — CID 5085394
[1-[(3,5-dimethylphenoxy)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]-(4-nitrophenyl)methanone (PubChem CID 5085394) has the molecular formula C27H28N2O6 and a molecular weight of 476.53 g/mol. Its IUPAC name is [1-[(3,5-dimethylphenoxy)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]-(4-nitrophenyl)methanone.
| Compound Name | [1-[(3,5-dimethylphenoxy)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]-(4-nitrophenyl)methanone |
|---|---|
| PubChem CID | 5085394 |
| Molecular Formula | C27H28N2O6 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | [1-[(3,5-dimethylphenoxy)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]-(4-nitrophenyl)methanone |
| SMILES | COc1cc2c(cc1OC)C(COc1cc(C)cc(C)c1)N(C(=O)c1ccc([N+](=O)[O-])cc1)CC2 |
| InChI | InChI=1S/C27H28N2O6/c1-17-11-18(2)13-22(12-17)35-16-24-23-15-26(34-4)25(33-3)14-20(23)9-10-28(24)27(30)19-5-7-21(8-6-19)29(31)32/h5-8,11-15,24H,9-10,16H2,1-4H3 |
| InChIKey | SHSXKWHFEKXTDQ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 91.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|