C29H32N2O8 — CID 3640760
(3,4-diethoxyphenyl)-[6,7-dimethoxy-1-[(4-nitrophenoxy)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]methanone (PubChem CID 3640760) has the molecular formula C29H32N2O8 and a molecular weight of 536.58 g/mol. Its IUPAC name is (3,4-diethoxyphenyl)-[6,7-dimethoxy-1-[(4-nitrophenoxy)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]methanone.
| Compound Name | (3,4-diethoxyphenyl)-[6,7-dimethoxy-1-[(4-nitrophenoxy)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]methanone |
|---|---|
| PubChem CID | 3640760 |
| Molecular Formula | C29H32N2O8 |
| Molecular Weight | 536.58 g/mol |
| Exact Mass | 536.22 |
| IUPAC Name | (3,4-diethoxyphenyl)-[6,7-dimethoxy-1-[(4-nitrophenoxy)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]methanone |
| SMILES | CCOc1ccc(C(=O)N2CCc3cc(OC)c(OC)cc3C2COc2ccc([N+](=O)[O-])cc2)cc1OCC |
| InChI | InChI=1S/C29H32N2O8/c1-5-37-25-12-7-20(16-28(25)38-6-2)29(32)30-14-13-19-15-26(35-3)27(36-4)17-23(19)24(30)18-39-22-10-8-21(9-11-22)31(33)34/h7-12,15-17,24H,5-6,13-14,18H2,1-4H3 |
| InChIKey | DUCIRFIRMUSLDR-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 109.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.58 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|