C21H23ClN2O6 — CID 43948859
3-chloro-1-[6,7-dimethoxy-1-[(4-nitrophenoxy)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]propan-1-one (PubChem CID 43948859) has the molecular formula C21H23ClN2O6 and a molecular weight of 434.88 g/mol. Its IUPAC name is 3-chloro-1-[6,7-dimethoxy-1-[(4-nitrophenoxy)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]propan-1-one.
| Compound Name | 3-chloro-1-[6,7-dimethoxy-1-[(4-nitrophenoxy)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]propan-1-one |
|---|---|
| PubChem CID | 43948859 |
| Molecular Formula | C21H23ClN2O6 |
| Molecular Weight | 434.88 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | 3-chloro-1-[6,7-dimethoxy-1-[(4-nitrophenoxy)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]propan-1-one |
| SMILES | COc1cc2c(cc1OC)C(COc1ccc([N+](=O)[O-])cc1)N(C(=O)CCCl)CC2 |
| InChI | InChI=1S/C21H23ClN2O6/c1-28-19-11-14-8-10-23(21(25)7-9-22)18(17(14)12-20(19)29-2)13-30-16-5-3-15(4-6-16)24(26)27/h3-6,11-12,18H,7-10,13H2,1-2H3 |
| InChIKey | OQLAPQUCAZRTOD-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 91.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.88 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|