C29H38N2O6 — CID 23990589
(4-butylcyclohexyl)-[6,7-dimethoxy-1-[(4-nitrophenoxy)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]methanone (PubChem CID 23990589) has the molecular formula C29H38N2O6 and a molecular weight of 510.63 g/mol. Its IUPAC name is (4-butylcyclohexyl)-[6,7-dimethoxy-1-[(4-nitrophenoxy)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]methanone.
| Compound Name | (4-butylcyclohexyl)-[6,7-dimethoxy-1-[(4-nitrophenoxy)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]methanone |
|---|---|
| PubChem CID | 23990589 |
| Molecular Formula | C29H38N2O6 |
| Molecular Weight | 510.63 g/mol |
| Exact Mass | 510.27 |
| IUPAC Name | (4-butylcyclohexyl)-[6,7-dimethoxy-1-[(4-nitrophenoxy)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]methanone |
| SMILES | CCCCC1CCC(C(=O)N2CCc3cc(OC)c(OC)cc3C2COc2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C29H38N2O6/c1-4-5-6-20-7-9-21(10-8-20)29(32)30-16-15-22-17-27(35-2)28(36-3)18-25(22)26(30)19-37-24-13-11-23(12-14-24)31(33)34/h11-14,17-18,20-21,26H,4-10,15-16,19H2,1-3H3 |
| InChIKey | LIGGSFZFFBQKQN-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 91.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.63 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|