C22H26ClNO5 — CID 43948834
3-chloro-1-[6,7-dimethoxy-1-[(2-methoxyphenoxy)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]propan-1-one (PubChem CID 43948834) has the molecular formula C22H26ClNO5 and a molecular weight of 419.91 g/mol. Its IUPAC name is 3-chloro-1-[6,7-dimethoxy-1-[(2-methoxyphenoxy)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]propan-1-one.
| Compound Name | 3-chloro-1-[6,7-dimethoxy-1-[(2-methoxyphenoxy)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]propan-1-one |
|---|---|
| PubChem CID | 43948834 |
| Molecular Formula | C22H26ClNO5 |
| Molecular Weight | 419.91 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 3-chloro-1-[6,7-dimethoxy-1-[(2-methoxyphenoxy)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]propan-1-one |
| SMILES | COc1cc2c(cc1OC)C(COc1ccccc1OC)N(C(=O)CCCl)CC2 |
| InChI | InChI=1S/C22H26ClNO5/c1-26-18-6-4-5-7-19(18)29-14-17-16-13-21(28-3)20(27-2)12-15(16)9-11-24(17)22(25)8-10-23/h4-7,12-13,17H,8-11,14H2,1-3H3 |
| InChIKey | MOHYHJSAABNPGJ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.91 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|