C28H30N2O6 — CID 23800285
[1-[(3,5-dimethylphenoxy)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]-(4-methyl-3-nitrophenyl)methanone (PubChem CID 23800285) has the molecular formula C28H30N2O6 and a molecular weight of 490.56 g/mol. Its IUPAC name is [1-[(3,5-dimethylphenoxy)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]-(4-methyl-3-nitrophenyl)methanone.
| Compound Name | [1-[(3,5-dimethylphenoxy)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]-(4-methyl-3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 23800285 |
| Molecular Formula | C28H30N2O6 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | [1-[(3,5-dimethylphenoxy)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]-(4-methyl-3-nitrophenyl)methanone |
| SMILES | COc1cc2c(cc1OC)C(COc1cc(C)cc(C)c1)N(C(=O)c1ccc(C)c([N+](=O)[O-])c1)CC2 |
| InChI | InChI=1S/C28H30N2O6/c1-17-10-18(2)12-22(11-17)36-16-25-23-15-27(35-5)26(34-4)14-20(23)8-9-29(25)28(31)21-7-6-19(3)24(13-21)30(32)33/h6-7,10-15,25H,8-9,16H2,1-5H3 |
| InChIKey | HOFOYEVPJOBVHF-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 91.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|