C35H34N4O9 — CID 155555655
bis[(1S)-6,7-dimethoxy-1-(4-nitrophenyl)-3,4-dihydro-1H-isoquinolin-2-yl]methanone (PubChem CID 155555655) has the molecular formula C35H34N4O9 and a molecular weight of 654.68 g/mol. Its IUPAC name is bis[(1S)-6,7-dimethoxy-1-(4-nitrophenyl)-3,4-dihydro-1H-isoquinolin-2-yl]methanone.
| Compound Name | bis[(1S)-6,7-dimethoxy-1-(4-nitrophenyl)-3,4-dihydro-1H-isoquinolin-2-yl]methanone |
|---|---|
| PubChem CID | 155555655 |
| Molecular Formula | C35H34N4O9 |
| Molecular Weight | 654.68 g/mol |
| Exact Mass | 654.23 |
| IUPAC Name | bis[(1S)-6,7-dimethoxy-1-(4-nitrophenyl)-3,4-dihydro-1H-isoquinolin-2-yl]methanone |
| SMILES | COc1cc2c(cc1OC)[C@H](c1ccc([N+](=O)[O-])cc1)N(C(=O)N1CCc3cc(OC)c(OC)cc3[C@@H]1c1ccc([N+](=O)[O-])cc1)CC2 |
| InChI | InChI=1S/C35H34N4O9/c1-45-29-17-23-13-15-36(33(27(23)19-31(29)47-3)21-5-9-25(10-6-21)38(41)42)35(40)37-16-14-24-18-30(46-2)32(48-4)20-28(24)34(37)22-7-11-26(12-8-22)39(43)44/h5-12,17-20,33-34H,13-16H2,1-4H3/t33-,34-/m0/s1 |
| InChIKey | GTBSLFLOGSBNAI-HEVIKAOCSA-N |
| XLogP | 6.25 |
| TPSA | 146.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.68 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|