C20H22ClNO5 — CID 21486964
1-(3,4-dimethoxyphenyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carbonyl chloride (PubChem CID 21486964) has the molecular formula C20H22ClNO5 and a molecular weight of 391.85 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carbonyl chloride.
| Compound Name | 1-(3,4-dimethoxyphenyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carbonyl chloride |
|---|---|
| PubChem CID | 21486964 |
| Molecular Formula | C20H22ClNO5 |
| Molecular Weight | 391.85 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carbonyl chloride |
| SMILES | COc1ccc(C2c3cc(OC)c(OC)cc3CCN2C(=O)Cl)cc1OC |
| InChI | InChI=1S/C20H22ClNO5/c1-24-15-6-5-13(10-16(15)25-2)19-14-11-18(27-4)17(26-3)9-12(14)7-8-22(19)20(21)23/h5-6,9-11,19H,7-8H2,1-4H3 |
| InChIKey | LXIOOJWOIYSQSG-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.85 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|