C21H24N2O2S — CID 7945218
(1R)-N-cyclopropyl-6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinoline-2-carbothioamide (PubChem CID 7945218) has the molecular formula C21H24N2O2S and a molecular weight of 368.50 g/mol. Its IUPAC name is (1R)-N-cyclopropyl-6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinoline-2-carbothioamide.
| Compound Name | (1R)-N-cyclopropyl-6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinoline-2-carbothioamide |
|---|---|
| PubChem CID | 7945218 |
| Molecular Formula | C21H24N2O2S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | (1R)-N-cyclopropyl-6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinoline-2-carbothioamide |
| SMILES | COc1cc2c(cc1OC)[C@@H](c1ccccc1)N(C(=S)NC1CC1)CC2 |
| InChI | InChI=1S/C21H24N2O2S/c1-24-18-12-15-10-11-23(21(26)22-16-8-9-16)20(14-6-4-3-5-7-14)17(15)13-19(18)25-2/h3-7,12-13,16,20H,8-11H2,1-2H3,(H,22,26)/t20-/m1/s1 |
| InChIKey | WJYYEJKNTPFQFS-HXUWFJFHSA-N |
| XLogP | 3.69 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|