C24H18F5NO3 — CID 92773311
[(1S)-6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl]-(2,3,4,5,6-pentafluorophenyl)methanone (PubChem CID 92773311) has the molecular formula C24H18F5NO3 and a molecular weight of 463.40 g/mol. Its IUPAC name is [(1S)-6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl]-(2,3,4,5,6-pentafluorophenyl)methanone.
| Compound Name | [(1S)-6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl]-(2,3,4,5,6-pentafluorophenyl)methanone |
|---|---|
| PubChem CID | 92773311 |
| Molecular Formula | C24H18F5NO3 |
| Molecular Weight | 463.40 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | [(1S)-6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl]-(2,3,4,5,6-pentafluorophenyl)methanone |
| SMILES | COc1cc2c(cc1OC)[C@H](c1ccccc1)N(C(=O)c1c(F)c(F)c(F)c(F)c1F)CC2 |
| InChI | InChI=1S/C24H18F5NO3/c1-32-15-10-13-8-9-30(24(31)17-18(25)20(27)22(29)21(28)19(17)26)23(12-6-4-3-5-7-12)14(13)11-16(15)33-2/h3-7,10-11,23H,8-9H2,1-2H3/t23-/m0/s1 |
| InChIKey | HBYFREVHIZYYDD-QHCPKHFHSA-N |
| XLogP | 5.19 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.40 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|