C24H17ClF5NO3 — CID 46095381
[1-(3-chlorophenyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]-(2,3,4,5,6-pentafluorophenyl)methanone (PubChem CID 46095381) has the molecular formula C24H17ClF5NO3 and a molecular weight of 497.85 g/mol. Its IUPAC name is [1-(3-chlorophenyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]-(2,3,4,5,6-pentafluorophenyl)methanone.
| Compound Name | [1-(3-chlorophenyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]-(2,3,4,5,6-pentafluorophenyl)methanone |
|---|---|
| PubChem CID | 46095381 |
| Molecular Formula | C24H17ClF5NO3 |
| Molecular Weight | 497.85 g/mol |
| Exact Mass | 497.08 |
| IUPAC Name | [1-(3-chlorophenyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]-(2,3,4,5,6-pentafluorophenyl)methanone |
| SMILES | COc1cc2c(cc1OC)C(c1cccc(Cl)c1)N(C(=O)c1c(F)c(F)c(F)c(F)c1F)CC2 |
| InChI | InChI=1S/C24H17ClF5NO3/c1-33-15-9-11-6-7-31(24(32)17-18(26)20(28)22(30)21(29)19(17)27)23(14(11)10-16(15)34-2)12-4-3-5-13(25)8-12/h3-5,8-10,23H,6-7H2,1-2H3 |
| InChIKey | BRSKIPAGNSLWDG-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.85 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|