C23H31N3O2S — CID 2579268
(1R)-N-[3-(dimethylamino)propyl]-6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinoline-2-carbothioamide (PubChem CID 2579268) has the molecular formula C23H31N3O2S and a molecular weight of 413.59 g/mol. Its IUPAC name is (1R)-N-[3-(dimethylamino)propyl]-6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinoline-2-carbothioamide.
| Compound Name | (1R)-N-[3-(dimethylamino)propyl]-6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinoline-2-carbothioamide |
|---|---|
| PubChem CID | 2579268 |
| Molecular Formula | C23H31N3O2S |
| Molecular Weight | 413.59 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | (1R)-N-[3-(dimethylamino)propyl]-6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinoline-2-carbothioamide |
| SMILES | COc1cc2c(cc1OC)[C@@H](c1ccccc1)N(C(=S)NCCCN(C)C)CC2 |
| InChI | InChI=1S/C23H31N3O2S/c1-25(2)13-8-12-24-23(29)26-14-11-18-15-20(27-3)21(28-4)16-19(18)22(26)17-9-6-5-7-10-17/h5-7,9-10,15-16,22H,8,11-14H2,1-4H3,(H,24,29)/t22-/m1/s1 |
| InChIKey | XDOBFRGUWQXCFV-JOCHJYFZSA-N |
| XLogP | 3.48 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.59 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|