C19H22N4O3 — CID 109272215
(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-[5-(prop-2-enylamino)pyrazin-2-yl]methanone (PubChem CID 109272215) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is (6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-[5-(prop-2-enylamino)pyrazin-2-yl]methanone.
| Compound Name | (6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-[5-(prop-2-enylamino)pyrazin-2-yl]methanone |
|---|---|
| PubChem CID | 109272215 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | (6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-[5-(prop-2-enylamino)pyrazin-2-yl]methanone |
| SMILES | C=CCNc1cnc(C(=O)N2CCc3cc(OC)c(OC)cc3C2)cn1 |
| InChI | InChI=1S/C19H22N4O3/c1-4-6-20-18-11-21-15(10-22-18)19(24)23-7-5-13-8-16(25-2)17(26-3)9-14(13)12-23/h4,8-11H,1,5-7,12H2,2-3H3,(H,20,22) |
| InChIKey | BZQLPFRSALAMCM-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|